cas: 2303-23-3 — see every product listed under this CAS number, including other names
6,6''-Oxybis(3'-chloro-3-nitro-1,1'-biphenyl), 97% (CAS 2303-23-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F732997-1G |
| cas | 2303-23-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Fluorochem | 10g | 638.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-chloro-3-(4-nitrophenoxy)benzene (CAS 2303-23-3) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 1-chloro-3-(4-nitrophenoxy)benzene. InChIKey: XEUAYIJJIQXNOO-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 1-chloro-3-(4-nitrophenoxy)benzene |
| InChIKey | XEUAYIJJIQXNOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)