CAS 1415226-40-2 appears in our catalog under these names: 5-(3-Chlorophenyl)-3-hydroxypicolinic acid, 95%, 5–(3–Chlorophenyl)–3–hydroxypicolinic acid, 5-(3-Chlorophenyl)-3-hydroxypicolinic acid 97%, 5-(3-Chlorophenyl)-3-hydroxy-2-pyridinecarboxylic acid, 97%, 97%, 5-(3-Chlorophenyl)-3-hydroxypicolinic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg.
5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid (CAS 1415226-40-2) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid. InChIKey: KMZAXKDGIXGPOF-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid |
| InChIKey | KMZAXKDGIXGPOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=C(N=C2)C(=O)O)O |
Computed by PubChem (NCBI)