Products 1262010-75-2

CAS 1262010-75-2 is the registry number for 5-(4-Chlorophenyl)-6-hydroxynicotinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4-chlorophenyl)-6-oxo-1H-pyridine-3-carboxylic acid (CAS 1262010-75-2) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 5-(4-chlorophenyl)-6-oxo-1H-pyridine-3-carboxylic acid. InChIKey: ANDWTEUTDIJBOP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO3
Molecular weight249.65 g/mol
IUPAC name5-(4-chlorophenyl)-6-oxo-1H-pyridine-3-carboxylic acid
InChIKeyANDWTEUTDIJBOP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CNC2=O)C(=O)O)Cl

Computed by PubChem (NCBI)