CAS 147269-16-7 appears in our catalog under these names: 6-(4-Chloro-phenyl)-2-oxo-1,2-dihydro-pyridine-3-carboxylic acid, 90%, 6-(4-Chloro-phenyl)-2-oxo-1,2-dihydro-pyridine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid (CAS 147269-16-7) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: CBGGWZGPODAQIL-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | CBGGWZGPODAQIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C(=O)N2)C(=O)O)Cl |
Computed by PubChem (NCBI)