CAS 289044-48-0 appears in our catalog under these names: 4-[(5-Chloropyridin-2-yl)oxy]benzoic acid, 95%, 4–((5–Chloropyridin–2–yl)oxy)benzoic acid, 4-((5-chloropyridin-2-yl)oxy)benzoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
4-[(5-chloro-2-pyridinyl)oxy]benzoic acid (CAS 289044-48-0) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 4-[(5-chloro-2-pyridinyl)oxy]benzoic acid. InChIKey: YLGCYYLGIDUOMC-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 4-[(5-chloro-2-pyridinyl)oxy]benzoic acid |
| InChIKey | YLGCYYLGIDUOMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)