Products 1629041-62-8

CAS 1629041-62-8 is the registry number for 4-(5-Chloro-2-hydroxyphenyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(5-chloro-2-hydroxyphenyl)pyridine-2-carboxylic acid (CAS 1629041-62-8) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 4-(5-chloro-2-hydroxyphenyl)pyridine-2-carboxylic acid. InChIKey: LYLPVSGTPVOUOT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO3
Molecular weight249.65 g/mol
IUPAC name4-(5-chloro-2-hydroxyphenyl)pyridine-2-carboxylic acid
InChIKeyLYLPVSGTPVOUOT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C2=CC(=NC=C2)C(=O)O)O

Computed by PubChem (NCBI)