CAS 147269-19-0 appears in our catalog under these names: 6-(3-Chlorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%, 6-(3-Chlorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic Acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid (CAS 147269-19-0) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: XAEDXOYCNKFXGA-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | XAEDXOYCNKFXGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)