Products 1227564-00-2
CAS 1227564-00-2 is the registry number for 6,7-Dichloro-1H-indole-3-carbaldehyde, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,7-dichloro-1H-indole-3-carbaldehyde (CAS 1227564-00-2) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 6,7-dichloro-1H-indole-3-carbaldehyde. InChIKey: OTJCHOSZKRCMIB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-3-carbaldehyde |
| InChIKey | OTJCHOSZKRCMIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CN2)C=O)Cl)Cl |
Computed by PubChem (NCBI)