CAS 203626-52-2 is the registry number for 7,8-Dichloro-4-hydroxyquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7,8-dichloro-1H-quinolin-4-one (CAS 203626-52-2) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 7,8-dichloro-1H-quinolin-4-one. InChIKey: BAKZFDCDUQGTCL-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 7,8-dichloro-1H-quinolin-4-one |
| InChIKey | BAKZFDCDUQGTCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C=CN2)Cl)Cl |
Computed by PubChem (NCBI)