CAS 57935-38-3 appears in our catalog under these names: 6,8-dichloroquinolin-4-ol, 95%, 6,8-Dichloroquinolin-4-ol, 97%, 4–Hydroxy–6,8–Dichloroquinoline, 6,8-dichloro-1,4-dihydroquinolin-4-one, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g.
6,8-dichloro-1H-quinolin-4-one (CAS 57935-38-3) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 6,8-dichloro-1H-quinolin-4-one. InChIKey: LXZBIKOKMYPBAN-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 6,8-dichloro-1H-quinolin-4-one |
| InChIKey | LXZBIKOKMYPBAN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C1=O)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)