Products 175211-71-9
CAS 175211-71-9 appears in our catalog under these names: 5-(2,6-Dichlorophenyl)oxazole, 95%, 5-(2,6-Dichlorophenyl)oxazole, 98%, 5-(2,6-dichlorophenyl)oxazole, ≥95%, ≥95%, 5-(2,6-Dichlorophenyl)oxazole. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(2,6-dichlorophenyl)-1,3-oxazole (CAS 175211-71-9) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 5-(2,6-dichlorophenyl)-1,3-oxazole. InChIKey: BDQNHDQAKZXKTP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 5-(2,6-dichlorophenyl)-1,3-oxazole |
| InChIKey | BDQNHDQAKZXKTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=CN=CO2)Cl |
Computed by PubChem (NCBI)