Products 115716-98-8
CAS 115716-98-8 is the registry number for (2Z)-2-(2,4-Dichlorophenyl)-3-hydroxyprop-2-enenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile (CAS 115716-98-8) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: (Z)-2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile. InChIKey: JYYKWIXMUMUGGD-AATRIKPKSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | (Z)-2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile |
| InChIKey | JYYKWIXMUMUGGD-AATRIKPKSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C(=C/O)/C#N |
Computed by PubChem (NCBI)