Products 1242336-71-5
CAS 1242336-71-5 is the registry number for 2-(2,4-Dichlorophenyl)oxazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(2,4-dichlorophenyl)-1,3-oxazole (CAS 1242336-71-5) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1,3-oxazole. InChIKey: YWHOOKZYOXJCSH-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1,3-oxazole |
| InChIKey | YWHOOKZYOXJCSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC=CO2 |
Computed by PubChem (NCBI)