CAS 39528-61-5 appears in our catalog under these names: 2,4-Dichlorobenzoylacetonitrile, 95%, 2,4-Dichlorobenzoylacetonitrile, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500mg.
3-(2,4-dichlorophenyl)-3-oxopropanenitrile (CAS 39528-61-5) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-3-oxopropanenitrile. InChIKey: AKSMJAXTUMPWCX-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-3-oxopropanenitrile |
| InChIKey | AKSMJAXTUMPWCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CC#N |
Computed by PubChem (NCBI)