Products 51070-63-4

CAS 51070-63-4 is the registry number for 6-((1,1-Dioxidotetrahydrothiophen-3-yl)amino)hexanoic acid, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-[(1,1-dioxothiolan-3-yl)amino]hexanoic acid (CAS 51070-63-4) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: 6-[(1,1-dioxothiolan-3-yl)amino]hexanoic acid. InChIKey: CVVAWTGCHUBFBE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO4S
Molecular weight249.33 g/mol
IUPAC name6-[(1,1-dioxothiolan-3-yl)amino]hexanoic acid
InChIKeyCVVAWTGCHUBFBE-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1NCCCCCC(=O)O

Computed by PubChem (NCBI)