CAS 792893-05-1 appears in our catalog under these names: N-(1,1-Dioxidotetrahydro-3-thienyl)leucine, 95%, 2-(1,1-Dioxo-tetrahydro-1lambda(6)-thiophen-3-ylamino)-4-methyl-pentanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid (CAS 792893-05-1) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid. InChIKey: TVGAJMRKHDUNPB-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | 2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid |
| InChIKey | TVGAJMRKHDUNPB-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)