CAS 595597-01-6 is the registry number for tert-Butyl n-(1,1-dioxothian-4-yl)carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl N-(1,1-dioxothian-4-yl)carbamate (CAS 595597-01-6) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: tert-butyl N-(1,1-dioxothian-4-yl)carbamate. InChIKey: XKAPOJQKLRKFFV-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | tert-butyl N-(1,1-dioxothian-4-yl)carbamate |
| InChIKey | XKAPOJQKLRKFFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCS(=O)(=O)CC1 |
Computed by PubChem (NCBI)