CAS 16947-82-3 appears in our catalog under these names: Boc-cys(et)-oh, 95%, Boc–Cys(Et)–OH, N-Boc-S-ethyl-L-cysteine , Boc-Cys(Et)-OH 97%, (R)-2-((tert-Butoxycarbonyl)amino)-3-(ethylthio)propanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
(2R)-3-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 16947-82-3) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: (2R)-3-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IBCCMMVPGKVLAX-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | (2R)-3-ethylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IBCCMMVPGKVLAX-ZETCQYMHSA-N |
| SMILES | CCSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)