CAS 110763-40-1 appears in our catalog under these names: N-Boc-l-(+)-penicillamine, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–3–mercapto–3–methylbutanoic acid, Boc-Pen-OH 97%, (R)-2-((tert-Butoxycarbonyl)amino)-3-mercapto-3-methylbutanoic acid, 97%, 97%, (R)-2-((tert-Butoxycarbonyl)amino)-3-mercapto-3-methylbutanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100mg.
(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoic acid (CAS 110763-40-1) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoic acid. InChIKey: KATRCIRDUXIZQK-ZCFIWIBFSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylbutanoic acid |
| InChIKey | KATRCIRDUXIZQK-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(C)S |
Computed by PubChem (NCBI)