CAS 82509-30-6 appears in our catalog under these names: (1R)-(-)-10-Camphorsulfonic acid ammonium salt, 95%, (1R)-(-)-10-CAMPHORSULFONIC ACID AMMONI&, Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, ammonium salt, ≥98%, ≥98%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 50G, 10g, 250g.
Azane;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (CAS 82509-30-6) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: azane;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid. InChIKey: JTMZBRWRXFAITF-YUWZRIFDSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | azane;[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| InChIKey | JTMZBRWRXFAITF-YUWZRIFDSA-N |
| SMILES | CC1([C@H]2CC[C@@]1(C(=O)C2)CS(=O)(=O)O)C.N |
Computed by PubChem (NCBI)