CAS 82835-08-3 is the registry number for methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-3-(methylsulfanyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoate (CAS 82835-08-3) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoate. InChIKey: QSJXTKFREWNBLH-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoate |
| InChIKey | QSJXTKFREWNBLH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC)C(=O)OC |
Computed by PubChem (NCBI)