cas: 7120-14-1 — see every product listed under this CAS number, including other names
6-(4-Nitrophenyl)imidazo(2,1-b)thiazole, 97% (CAS 7120-14-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A824644-10g |
| cas | 7120-14-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10987.27 Pln | |
| AmBeed | 5g | 7855.96 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole (CAS 7120-14-1) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole. InChIKey: JLETUFGLJXMETA-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| InChIKey | JLETUFGLJXMETA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)