CAS 1309159-74-7 is the registry number for 1-(Thiazol-2-yl)-1H-indazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,3-thiazol-2-yl)indazole-3-carboxylic acid (CAS 1309159-74-7) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 1-(1,3-thiazol-2-yl)indazole-3-carboxylic acid. InChIKey: OGGJNDUQFTXDJS-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 1-(1,3-thiazol-2-yl)indazole-3-carboxylic acid |
| InChIKey | OGGJNDUQFTXDJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2C3=NC=CS3)C(=O)O |
Computed by PubChem (NCBI)