CAS 7120-14-1 appears in our catalog under these names: 6-(4-Nitrophenyl)imidazo[2,1-b][1,3]thiazole, 95%, 6-(4-Nitrophenyl)imidazo(2,1-b)thiazole, 97%, 6-(4-Nitrophenyl)imidazo(2,1-b)(1,3)thiazole, 6-(4-Nitrophenyl)imidazo[2,1-b][1,3]thiazole, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 0,5g.
6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole (CAS 7120-14-1) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole. InChIKey: JLETUFGLJXMETA-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole |
| InChIKey | JLETUFGLJXMETA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)