CAS 1389455-64-4 is the registry number for 3-[3-(3-Thienyl)-1,2,4-oxadiazol-5-yl]pyridin-2(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one (CAS 1389455-64-4) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one. InChIKey: MLMBZQLCTHUGAO-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)-1H-pyridin-2-one |
| InChIKey | MLMBZQLCTHUGAO-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C(=C1)C2=NC(=NO2)C3=CSC=C3 |
Computed by PubChem (NCBI)