Products 74002-68-9
CAS 74002-68-9 is the registry number for 3-(Phenylsulfonyl)pyrazine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(benzenesulfonyl)pyrazine-2-carbonitrile (CAS 74002-68-9) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 3-(benzenesulfonyl)pyrazine-2-carbonitrile. InChIKey: VGUOAQYMXUDOTB-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 3-(benzenesulfonyl)pyrazine-2-carbonitrile |
| InChIKey | VGUOAQYMXUDOTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=NC=CN=C2C#N |
Computed by PubChem (NCBI)