Products 1023299-41-3
CAS 1023299-41-3 appears in our catalog under these names: 2-(1H-Indazol-1-yl)thiazole-4-carboxylic acid, 95%, 2-(1H-Indazol-1-yl)thiazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-indazol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1023299-41-3) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 2-indazol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: JMOXHSOGPUXLLK-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 2-indazol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | JMOXHSOGPUXLLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN2C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)