CAS 186792-85-8 is the registry number for 2-((2-Nitrophenyl)amino)-3-cyanothiophene. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2-(2-nitroanilino)thiophene-3-carbonitrile (CAS 186792-85-8) is a chemical compound with the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. IUPAC name: 2-(2-nitroanilino)thiophene-3-carbonitrile. InChIKey: BGBMKHNXWAGHQD-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 2-(2-nitroanilino)thiophene-3-carbonitrile |
| InChIKey | BGBMKHNXWAGHQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=C(C=CS2)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)