cas: 725256-57-5 — see every product listed under this CAS number, including other names
6-(Benzyloxy)pyridin-3-ol, 95% (CAS 725256-57-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210446-1G |
| cas | 725256-57-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 518.59 Pln | |
| Fluorochem | 25g | 1200.64 Pln | |
| Fluorochem | 100g | 4642.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-phenylmethoxypyridin-3-ol (CAS 725256-57-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 6-phenylmethoxypyridin-3-ol. InChIKey: VKPWAEVWZUALPZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-phenylmethoxypyridin-3-ol |
| InChIKey | VKPWAEVWZUALPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=C(C=C2)O |
Computed by PubChem (NCBI)