6-(Benzyloxy)pyridin-3-ol, 98%
cas: 725256-57-5 — see every product listed under this CAS number, including other names
6-(Benzyloxy)pyridin-3-ol, 98% (CAS 725256-57-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100g, 50g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | PY-7702-10g |
| cas | 725256-57-5 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1243.69 Pln | |
| Ambeed | 100g | 4759.19 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 429.20 Pln | |
| Chemat | 25g | 909.20 Pln | |
| Chemat | 50g | 1744.40 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 364.34 Pln | |
| BLDpharm | 10g | 575.38 Pln | |
| BLDpharm | 25g | 1336.22 Pln | |
| BLDpharm | 100g | 5123.78 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-phenylmethoxypyridin-3-ol (CAS 725256-57-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 6-phenylmethoxypyridin-3-ol. InChIKey: VKPWAEVWZUALPZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-phenylmethoxypyridin-3-ol |
| InChIKey | VKPWAEVWZUALPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=C(C=C2)O |
Computed by PubChem (NCBI)