6-(Difluoromethoxy)-2,3-dihydro-1H-inden-1-one, 95%
cas: 1092347-55-1 — see every product listed under this CAS number, including other names
6-(Difluoromethoxy)-2,3-dihydro-1H-inden-1-one, 95% (CAS 1092347-55-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A14495470-100mg |
| cas | 1092347-55-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1560.75 Pln | |
| Ambeed | 250mg | 2751.12 Pln | |
| Ambeed | 1g | 7039.81 Pln | |
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 2037.20 Pln | |
| Chemat | 1g | 5195.60 Pln | |
| BLDpharm | 100mg | 1680.54 Pln | |
| BLDpharm | 250mg | 2963.43 Pln | |
| BLDpharm | 1g | 7584.02 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-(difluoromethoxy)-2,3-dihydroinden-1-one (CAS 1092347-55-1) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 6-(difluoromethoxy)-2,3-dihydroinden-1-one. InChIKey: IIFUKOKDTFTKCA-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 6-(difluoromethoxy)-2,3-dihydroinden-1-one |
| InChIKey | IIFUKOKDTFTKCA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2)OC(F)F |
Computed by PubChem (NCBI)