Products 1092347-55-1
CAS 1092347-55-1 is the registry number for 6-(Difluoromethoxy)-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
6-(difluoromethoxy)-2,3-dihydroinden-1-one (CAS 1092347-55-1) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 6-(difluoromethoxy)-2,3-dihydroinden-1-one. InChIKey: IIFUKOKDTFTKCA-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 6-(difluoromethoxy)-2,3-dihydroinden-1-one |
| InChIKey | IIFUKOKDTFTKCA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2)OC(F)F |
Computed by PubChem (NCBI)