cas: 75414-00-5 — see every product listed under this CAS number, including other names
6-(TRIFLUOROMETHYL)-1,2,3,4-TETRAHYDROQUINOLINE, 97% (CAS 75414-00-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387359-100MG |
| cas | 75414-00-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 700.81 Pln | |
| Fluorochem | 1g | 1861.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 75414-00-5) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: SQJQPDGTZCRFBC-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | SQJQPDGTZCRFBC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)