cas: 75414-00-5 — see every product listed under this CAS number, including other names
6-Trifluoromethyl-1,2,3,4-tetrahydroquinoline, 97%, 97% (CAS 75414-00-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4Y8-5g |
| cas | 75414-00-5 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 5469.20 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 500mg | 966.80 Pln | |
| Chemat | 1g | 1542.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 75414-00-5) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: SQJQPDGTZCRFBC-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | SQJQPDGTZCRFBC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)