Products 135855-63-9
CAS 135855-63-9 is the registry number for 6-Amino-1H-indole-2-carboxylic acid, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg.
6-amino-1H-indole-2-carboxylic acid (CAS 135855-63-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-amino-1H-indole-2-carboxylic acid. InChIKey: NVTAPSGYTBQTAQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-amino-1H-indole-2-carboxylic acid |
| InChIKey | NVTAPSGYTBQTAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)