cas: 20332-16-5 — see every product listed under this CAS number, including other names
6-Aminobenzo[d][1,3]dioxole-5-carboxylic acid, 97%, 97% (CAS 20332-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1139UB-100mg |
| cas | 20332-16-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1374.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-amino-1,3-benzodioxole-5-carboxylic acid (CAS 20332-16-5) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-amino-1,3-benzodioxole-5-carboxylic acid. InChIKey: OJTOAMSTANUUMJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-amino-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | OJTOAMSTANUUMJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)N |
Computed by PubChem (NCBI)