cas: 1017783-09-3 — see every product listed under this CAS number, including other names
6-Bromo-1,4-dihydro-2H-3,1-benzoxazin-2-one, 96%, 96% (CAS 1017783-09-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116JE-10g |
| cas | 1017783-09-3 |
| size | 10g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1154.00 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 722.00 Pln | |
| Chemat | 25g | 2243.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-bromo-1,4-dihydro-3,1-benzoxazin-2-one (CAS 1017783-09-3) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: SSTOTANBGDRSRF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | SSTOTANBGDRSRF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)NC(=O)O1 |
Computed by PubChem (NCBI)