cas: 19165-25-4 — see every product listed under this CAS number, including other names
6-Bromo-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 95%, 95% (CAS 19165-25-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FEN-100mg |
| cas | 19165-25-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1250.00 Pln | |
| Chemat | 1g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-methyl-3,1-benzoxazin-4-one (CAS 19165-25-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 6-bromo-2-methyl-3,1-benzoxazin-4-one. InChIKey: JCRULBKTDUOWMP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 6-bromo-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | JCRULBKTDUOWMP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)