cas: 910777-49-0 — see every product listed under this CAS number, including other names
6-Bromo-2-methylimidazo[1,2-a]pyridin-8-amine 95% (CAS 910777-49-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473861-50mg |
| cas | 910777-49-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 364.81 Pln | |
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 1043.44 Pln | |
| Ambeed | 1g | 2155.94 Pln | |
| Ambeed | 5g | 6322.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A473861 |
6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine (CAS 910777-49-0) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine. InChIKey: NSOVSVVWLOMLPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine |
| InChIKey | NSOVSVVWLOMLPQ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C=C(C2=N1)N)Br |
Computed by PubChem (NCBI)