cas: 910777-49-0 — see every product listed under this CAS number, including other names
6-Bromo-2-methylimidazo[1,2-a]pyridin-8-amine, 95%, 95% (CAS 910777-49-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGH3-50mg |
| cas | 910777-49-0 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 237.20 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 1g | 1254.80 Pln | |
| Chemat | 5g | 3640.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine (CAS 910777-49-0) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine. InChIKey: NSOVSVVWLOMLPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-2-methylimidazo[1,2-a]pyridin-8-amine |
| InChIKey | NSOVSVVWLOMLPQ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C=C(C2=N1)N)Br |
Computed by PubChem (NCBI)