cas: 21440-97-1 — see every product listed under this CAS number, including other names
6-Bromo-4,4-dimethyl-1,4-dihydrobenzo[d][1,3]oxazin-2-one, 98%, 98% (CAS 21440-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I56A-100mg |
| cas | 21440-97-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1734.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 21440-97-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: JRXGULDSFFLUAO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | JRXGULDSFFLUAO-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)