cas: 21440-97-1 — see every product listed under this CAS number, including other names
Brofoxine 98% (CAS 21440-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412846-100mg |
| cas | 21440-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2050.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A412846 |
6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 21440-97-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: JRXGULDSFFLUAO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | JRXGULDSFFLUAO-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)