cas: 1936429-80-9 — see every product listed under this CAS number, including other names
6-Bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline, 98%, 98% (CAS 1936429-80-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XH2O-100g |
| cas | 1936429-80-9 |
| size | 100g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5958.80 Pln | |
| Chemat | 250g | 12606.80 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1936429-80-9) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: YSIQFNDARSIHNB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | YSIQFNDARSIHNB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2NC1)C(F)F)Br |
Computed by PubChem (NCBI)