CAS 889861-17-0 is the registry number for 7-Bromo-3-(difluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3-(difluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 889861-17-0) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 7-bromo-3-(difluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: ARNKQLYWYANBBE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 7-bromo-3-(difluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | ARNKQLYWYANBBE-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=C1C=CC(=C2)Br)C(F)F |
Computed by PubChem (NCBI)