CAS 2230149-10-5 is the registry number for 1-(2-Bromo-3,6-difluorobenzyl)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2-bromo-3,6-difluorophenyl)methyl]azetidine (CAS 2230149-10-5) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 1-[(2-bromo-3,6-difluorophenyl)methyl]azetidine. InChIKey: OAXZEKOZZZWRNI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 1-[(2-bromo-3,6-difluorophenyl)methyl]azetidine |
| InChIKey | OAXZEKOZZZWRNI-UHFFFAOYSA-N |
| SMILES | C1CN(C1)CC2=C(C=CC(=C2Br)F)F |
Computed by PubChem (NCBI)