CAS 1875199-07-7 is the registry number for 4-Bromo-n-(cyclopropylmethyl)-3,5-difluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-bromo-N-(cyclopropylmethyl)-3,5-difluoroaniline (CAS 1875199-07-7) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 4-bromo-N-(cyclopropylmethyl)-3,5-difluoroaniline. InChIKey: JVAIFJODXIHCRR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 4-bromo-N-(cyclopropylmethyl)-3,5-difluoroaniline |
| InChIKey | JVAIFJODXIHCRR-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2=CC(=C(C(=C2)F)Br)F |
Computed by PubChem (NCBI)