Products 1936429-80-9
CAS 1936429-80-9 appears in our catalog under these names: 6-Bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline, 6-Bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline, 98%, 98%, 6-Bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline, 98%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 100g, 250g, 100mg, 250mg, 1g, 5g, 10g.
6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1936429-80-9) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: YSIQFNDARSIHNB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 6-bromo-7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | YSIQFNDARSIHNB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2NC1)C(F)F)Br |
Computed by PubChem (NCBI)