CAS 1552637-04-3 is the registry number for 1-(4-Bromophenyl)-3,3-difluorocyclobutan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-3,3-difluorocyclobutan-1-amine (CAS 1552637-04-3) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 1-(4-bromophenyl)-3,3-difluorocyclobutan-1-amine. InChIKey: LUABIUALKGUCFG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,3-difluorocyclobutan-1-amine |
| InChIKey | LUABIUALKGUCFG-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)