CAS 1521082-06-3 is the registry number for 1-(4-Bromo-2,6-difluorophenyl)pyrrolidine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1-(4-bromo-2,6-difluorophenyl)pyrrolidine (CAS 1521082-06-3) is a chemical compound with the molecular formula C10H10BrF2N and a molecular weight of 262.09 g/mol. IUPAC name: 1-(4-bromo-2,6-difluorophenyl)pyrrolidine. InChIKey: UVWXWDSDICTJNL-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2N |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 1-(4-bromo-2,6-difluorophenyl)pyrrolidine |
| InChIKey | UVWXWDSDICTJNL-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=C2F)Br)F |
Computed by PubChem (NCBI)