6-Bromo-7-methylindoline-2,3-dione, 97%
cas: 129833-54-1 — see every product listed under this CAS number, including other names
6-Bromo-7-methylindoline-2,3-dione, 97% (CAS 129833-54-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111TQH-100mg |
| cas | 129833-54-1 |
| size | 100mg |
| availability | 2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1005.20 Pln | |
| Chemat | 250mg | 1408.40 Pln | |
| Chemat | 500mg | 2190.80 Pln | |
| Chemat | 1g | 2781.20 Pln | |
| Fluorochem | 100mg | 1289.15 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 500mg | 2799.03 Pln | |
| Fluorochem | 1g | 3522.74 Pln | |
| Fluorochem | 5g | 10259.95 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-7-methyl-1H-indole-2,3-dione (CAS 129833-54-1) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 6-bromo-7-methyl-1H-indole-2,3-dione. InChIKey: GTMRDSCDZYHHFY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 6-bromo-7-methyl-1H-indole-2,3-dione |
| InChIKey | GTMRDSCDZYHHFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2=O)Br |
Computed by PubChem (NCBI)